C20H20F3N3O3 — CID 66837107
2-[1-(2-methylquinolin-4-yl)-4-[(E)-4,4,4-trifluorobut-2-enoyl]piperazin-2-yl]acetic acid (PubChem CID 66837107) has the molecular formula C20H20F3N3O3 and a molecular weight of 407.39 g/mol. Its IUPAC name is 2-[1-(2-methylquinolin-4-yl)-4-[(E)-4,4,4-trifluorobut-2-enoyl]piperazin-2-yl]acetic acid.
| Compound Name | 2-[1-(2-methylquinolin-4-yl)-4-[(E)-4,4,4-trifluorobut-2-enoyl]piperazin-2-yl]acetic acid |
|---|---|
| PubChem CID | 66837107 |
| Molecular Formula | C20H20F3N3O3 |
| Molecular Weight | 407.39 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | 2-[1-(2-methylquinolin-4-yl)-4-[(E)-4,4,4-trifluorobut-2-enoyl]piperazin-2-yl]acetic acid |
| SMILES | Cc1cc(N2CCN(C(=O)/C=C/C(F)(F)F)CC2CC(=O)O)c2ccccc2n1 |
| InChI | InChI=1S/C20H20F3N3O3/c1-13-10-17(15-4-2-3-5-16(15)24-13)26-9-8-25(12-14(26)11-19(28)29)18(27)6-7-20(21,22)23/h2-7,10,14H,8-9,11-12H2,1H3,(H,28,29)/b7-6+ |
| InChIKey | GSVCHBWKXFEKRX-VOTSOKGWSA-N |
| XLogP | 3.15 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|