About 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine
8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine (PubChem CID 66837152) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine.
Analyze 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine?
The IUPAC name of 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine (CID 66837152) is 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine.
What is the SMILES notation for 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine?
The canonical SMILES for 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine is CC1=CNC=C2OCCOC2=C1.
What is the InChIKey of 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine?
The InChIKey is JDIVNNYXDCRPKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-7-4-8-9(6-10-5-7)12-3-2-11-8/h4-6,10H,2-3H2,1H3.
What are the key properties of 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine?
8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine has a molecular weight of 165.19 g/mol, XLogP of 1.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-methyl-3,6-dihydro-2H-[1,4]dioxino[2,3-c]azepine is sourced from PubChem (CID 66837152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).