About methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate
methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate (PubChem CID 66837199) has the molecular formula C12H23FN2O3
and a molecular weight of 262.32 g/mol. Its IUPAC name is methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate.
Molecular Properties
| Compound Name | methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate |
| PubChem CID | 66837199 |
| Molecular Formula | C12H23FN2O3 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate |
| SMILES | COC(=O)N[C@@H](C(C)C)C(O)N1C[C@H](F)C[C@H]1C |
| InChI | InChI=1S/C12H23FN2O3/c1-7(2)10(14-12(17)18-4)11(16)15-6-9(13)5-8(15)3/h7-11,16H,5-6H2,1-4H3,(H,14,17)/t8-,9-,10+,11?/m1/s1 |
| InChIKey | GTDFJTGJBKGGRQ-NFLHVTIKSA-N |
| XLogP | 1.12 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate?
The IUPAC name of methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate (CID 66837199) is methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate.
What is the SMILES notation for methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate?
The canonical SMILES for methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate is COC(=O)N[C@@H](C(C)C)C(O)N1C[C@H](F)C[C@H]1C.
What is the InChIKey of methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate?
The InChIKey is GTDFJTGJBKGGRQ-NFLHVTIKSA-N. The full InChI is InChI=1S/C12H23FN2O3/c1-7(2)10(14-12(17)18-4)11(16)15-6-9(13)5-8(15)3/h7-11,16H,5-6H2,1-4H3,(H,14,17)/t8-,9-,10+,11?/m1/s1.
What are the key properties of methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate?
methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate has a molecular weight of 262.32 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-[(2S)-1-[(2R,4R)-4-fluoro-2-methylpyrrolidin-1-yl]-1-hydroxy-3-methylbutan-2-yl]carbamate is sourced from PubChem (CID 66837199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).