C37H45BN4O5 — CID 66837267
tert-butyl (3S)-3-[5-[6-methyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazin-3-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.2]octane-2-carboxylate (PubChem CID 66837267) has the molecular formula C37H45BN4O5 and a molecular weight of 636.60 g/mol. Its IUPAC name is tert-butyl (3S)-3-[5-[6-methyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazin-3-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | tert-butyl (3S)-3-[5-[6-methyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazin-3-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 66837267 |
| Molecular Formula | C37H45BN4O5 |
| Molecular Weight | 636.60 g/mol |
| Exact Mass | 636.35 |
| IUPAC Name | tert-butyl (3S)-3-[5-[6-methyl-10-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-6H-indolo[1,2-c][1,3]benzoxazin-3-yl]-1H-imidazol-2-yl]-2-azabicyclo[2.2.2]octane-2-carboxylate |
| SMILES | CC1Oc2cc(-c3cnc([C@@H]4C5CCC(CC5)N4C(=O)OC(C)(C)C)[nH]3)ccc2-c2cc3cc(B4OC(C)(C)C(C)(C)O4)ccc3n21 |
| InChI | InChI=1S/C37H45BN4O5/c1-21-41-29-16-12-25(38-46-36(5,6)37(7,8)47-38)17-24(29)18-30(41)27-15-11-23(19-31(27)44-21)28-20-39-33(40-28)32-22-9-13-26(14-10-22)42(32)34(43)45-35(2,3)4/h11-12,15-22,26,32H,9-10,13-14H2,1-8H3,(H,39,40)/t21?,22?,26?,32-/m0/s1 |
| InChIKey | XVOPCOCOIQPDLA-MYEONQPVSA-N |
| XLogP | 7.76 |
| TPSA | 90.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.60 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|