About (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol
(2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol (PubChem CID 66837420) has the molecular formula C10H20F2N2O
and a molecular weight of 222.28 g/mol. Its IUPAC name is (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol |
| PubChem CID | 66837420 |
| Molecular Formula | C10H20F2N2O |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol |
| SMILES | CC(C)[C@H](N)C(O)N1CC(F)(F)C[C@H]1C |
| InChI | InChI=1S/C10H20F2N2O/c1-6(2)8(13)9(15)14-5-10(11,12)4-7(14)3/h6-9,15H,4-5,13H2,1-3H3/t7-,8+,9?/m1/s1 |
| InChIKey | FTVVCNGJAAZUTC-WGTSGOJVSA-N |
| XLogP | 1.02 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol?
The IUPAC name of (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol (CID 66837420) is (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol.
What is the SMILES notation for (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol?
The canonical SMILES for (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol is CC(C)[C@H](N)C(O)N1CC(F)(F)C[C@H]1C.
What is the InChIKey of (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol?
The InChIKey is FTVVCNGJAAZUTC-WGTSGOJVSA-N. The full InChI is InChI=1S/C10H20F2N2O/c1-6(2)8(13)9(15)14-5-10(11,12)4-7(14)3/h6-9,15H,4-5,13H2,1-3H3/t7-,8+,9?/m1/s1.
What are the key properties of (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol?
(2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol has a molecular weight of 222.28 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-1-[(2R)-4,4-difluoro-2-methylpyrrolidin-1-yl]-3-methylbutan-1-ol is sourced from PubChem (CID 66837420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).