C19H22Cl2FNO2 — CID 66837713
prop-1-en-2-yl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-(2-fluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 66837713) has the molecular formula C19H22Cl2FNO2 and a molecular weight of 386.29 g/mol. Its IUPAC name is prop-1-en-2-yl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-(2-fluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | prop-1-en-2-yl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-(2-fluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 66837713 |
| Molecular Formula | C19H22Cl2FNO2 |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | prop-1-en-2-yl (3aR,6aS)-3a-(3,4-dichlorophenyl)-5-(2-fluoroethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | C=C(C)OC(=O)N1C[C@H]2CC(CCF)C[C@@]2(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H22Cl2FNO2/c1-12(2)25-18(24)23-10-15-7-13(5-6-22)9-19(15,11-23)14-3-4-16(20)17(21)8-14/h3-4,8,13,15H,1,5-7,9-11H2,2H3/t13?,15-,19+/m1/s1 |
| InChIKey | RVFUUOLEGPVYOD-NRYXDWBNSA-N |
| XLogP | 5.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|