C26H38FNO2 — CID 66838149
5-[2-[[(3-fluorophenyl)methylamino]methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol (PubChem CID 66838149) has the molecular formula C26H38FNO2 and a molecular weight of 415.59 g/mol. Its IUPAC name is 5-[2-[[(3-fluorophenyl)methylamino]methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol.
| Compound Name | 5-[2-[[(3-fluorophenyl)methylamino]methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
|---|---|
| PubChem CID | 66838149 |
| Molecular Formula | C26H38FNO2 |
| Molecular Weight | 415.59 g/mol |
| Exact Mass | 415.29 |
| IUPAC Name | 5-[2-[[(3-fluorophenyl)methylamino]methyl]-4-hydroxy-1-methylcyclohexyl]-7a-methyl-1-methylidene-3,3a,4,5,6,7-hexahydro-2H-inden-4-ol |
| SMILES | C=C1CCC2C(O)C(C3(C)CCC(O)CC3CNCc3cccc(F)c3)CCC12C |
| InChI | InChI=1S/C26H38FNO2/c1-17-7-8-22-24(30)23(10-12-25(17,22)2)26(3)11-9-21(29)14-19(26)16-28-15-18-5-4-6-20(27)13-18/h4-6,13,19,21-24,28-30H,1,7-12,14-16H2,2-3H3 |
| InChIKey | ACFKYMDOOFONCY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|