About azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole
azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole (PubChem CID 66838232) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole |
| PubChem CID | 66838232 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole |
| SMILES | CCCN1CCc2ccc(SC)cc21.N |
| InChI | InChI=1S/C12H17NS.H3N/c1-3-7-13-8-6-10-4-5-11(14-2)9-12(10)13;/h4-5,9H,3,6-8H2,1-2H3;1H3 |
| InChIKey | UTFFHJIDZQFHBW-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole?
The IUPAC name of azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole (CID 66838232) is azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole.
What is the SMILES notation for azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole?
The canonical SMILES for azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole is CCCN1CCc2ccc(SC)cc21.N.
What is the InChIKey of azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole?
The InChIKey is UTFFHJIDZQFHBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NS.H3N/c1-3-7-13-8-6-10-4-5-11(14-2)9-12(10)13;/h4-5,9H,3,6-8H2,1-2H3;1H3.
What are the key properties of azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole?
azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole has a molecular weight of 224.37 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;6-methylsulfanyl-1-propyl-2,3-dihydroindole is sourced from PubChem (CID 66838232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).