About 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate
1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 66838781) has the molecular formula C14H26F3NO3
and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate |
| PubChem CID | 66838781 |
| Molecular Formula | C14H26F3NO3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCCC[N+]1(COC(C)C)CCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C12H26NO.C2HF3O2/c1-4-5-8-13(9-6-7-10-13)11-14-12(2)3;3-2(4,5)1(6)7/h12H,4-11H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | RQSZUYZYZBVWAJ-UHFFFAOYSA-M |
| XLogP | 2.08 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate?
The IUPAC name of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate (CID 66838781) is 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate.
What is the SMILES notation for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate?
The canonical SMILES for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate is CCCC[N+]1(COC(C)C)CCCC1.O=C([O-])C(F)(F)F.
What is the InChIKey of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate?
The InChIKey is RQSZUYZYZBVWAJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H26NO.C2HF3O2/c1-4-5-8-13(9-6-7-10-13)11-14-12(2)3;3-2(4,5)1(6)7/h12H,4-11H2,1-3H3;(H,6,7)/q+1;/p-1.
What are the key properties of 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate?
1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate has a molecular weight of 313.36 g/mol, XLogP of 2.08, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-1-(propan-2-yloxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate is sourced from PubChem (CID 66838781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).