C13H24F3NO3 — CID 66838819
1-propan-2-yl-1-(propoxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate (PubChem CID 66838819) has the molecular formula C13H24F3NO3 and a molecular weight of 299.33 g/mol. Its IUPAC name is 1-propan-2-yl-1-(propoxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-propan-2-yl-1-(propoxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 66838819 |
| Molecular Formula | C13H24F3NO3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 1-propan-2-yl-1-(propoxymethyl)pyrrolidin-1-ium;2,2,2-trifluoroacetate |
| SMILES | CCCOC[N+]1(C(C)C)CCCC1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C11H24NO.C2HF3O2/c1-4-9-13-10-12(11(2)3)7-5-6-8-12;3-2(4,5)1(6)7/h11H,4-10H2,1-3H3;(H,6,7)/q+1;/p-1 |
| InChIKey | QVFKOUKTEJQBCH-UHFFFAOYSA-M |
| XLogP | 1.69 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|