C34H35F3O4Si — CID 66838983
benzyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-(3,4,5-trifluorophenyl)pentanoate (PubChem CID 66838983) has the molecular formula C34H35F3O4Si and a molecular weight of 592.73 g/mol. Its IUPAC name is benzyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-(3,4,5-trifluorophenyl)pentanoate.
| Compound Name | benzyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-(3,4,5-trifluorophenyl)pentanoate |
|---|---|
| PubChem CID | 66838983 |
| Molecular Formula | C34H35F3O4Si |
| Molecular Weight | 592.73 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | benzyl (2S,3R)-5-[tert-butyl(diphenyl)silyl]oxy-3-hydroxy-2-(3,4,5-trifluorophenyl)pentanoate |
| SMILES | CC(C)(C)[Si](OCC[C@@H](O)[C@@H](C(=O)OCc1ccccc1)c1cc(F)c(F)c(F)c1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H35F3O4Si/c1-34(2,3)42(26-15-9-5-10-16-26,27-17-11-6-12-18-27)41-20-19-30(38)31(25-21-28(35)32(37)29(36)22-25)33(39)40-23-24-13-7-4-8-14-24/h4-18,21-22,30-31,38H,19-20,23H2,1-3H3/t30-,31+/m1/s1 |
| InChIKey | SGISNDACBLUKQZ-JSOSNVBQSA-N |
| XLogP | 6.26 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.73 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|