C36H39F3O5Si — CID 66838993
(2S,3R)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid (PubChem CID 66838993) has the molecular formula C36H39F3O5Si and a molecular weight of 636.78 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid.
| Compound Name | (2S,3R)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid |
|---|---|
| PubChem CID | 66838993 |
| Molecular Formula | C36H39F3O5Si |
| Molecular Weight | 636.78 g/mol |
| Exact Mass | 636.25 |
| IUPAC Name | (2S,3R)-2-benzyl-5-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)-2-(3,4,5-trifluorophenyl)pentanoic acid |
| SMILES | COCO[C@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@](Cc1ccccc1)(C(=O)O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C36H39F3O5Si/c1-35(2,3)45(28-16-10-6-11-17-28,29-18-12-7-13-19-29)44-21-20-32(43-25-42-4)36(34(40)41,24-26-14-8-5-9-15-26)27-22-30(37)33(39)31(38)23-27/h5-19,22-23,32H,20-21,24-25H2,1-4H3,(H,40,41)/t32-,36+/m1/s1 |
| InChIKey | QDAXETWUPINQAT-KUFVUHJUSA-N |
| XLogP | 6.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.78 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|