About N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride
N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride (PubChem CID 66839305) has the molecular formula C16H29ClN2
and a molecular weight of 284.87 g/mol. Its IUPAC name is N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride |
| PubChem CID | 66839305 |
| Molecular Formula | C16H29ClN2 |
| Molecular Weight | 284.87 g/mol |
| Exact Mass | 284.20 |
| IUPAC Name | N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\CCC12CC3CC(C)(CC(C)(C3)C1)C2.Cl |
| InChI | InChI=1S/C16H28N2.ClH/c1-12(17)18-5-4-16-8-13-6-14(2,10-16)9-15(3,7-13)11-16;/h13H,4-11H2,1-3H3,(H2,17,18);1H |
| InChIKey | VQDYWKYNFKAWCY-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride?
The IUPAC name of N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride (CID 66839305) is N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride.
What is the SMILES notation for N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride?
The canonical SMILES for N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride is C/C(N)=N\CCC12CC3CC(C)(CC(C)(C3)C1)C2.Cl.
What is the InChIKey of N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride?
The InChIKey is VQDYWKYNFKAWCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2.ClH/c1-12(17)18-5-4-16-8-13-6-14(2,10-16)9-15(3,7-13)11-16;/h13H,4-11H2,1-3H3,(H2,17,18);1H.
What are the key properties of N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride?
N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride has a molecular weight of 284.87 g/mol, XLogP of 4.17, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(3,5-dimethyl-1-adamantyl)ethyl]ethanimidamide;hydrochloride is sourced from PubChem (CID 66839305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).