C22H30N4O4 — CID 66839770
tert-butyl-[1-[(6,12-dioxo-1,5-diazatricyclo[7.3.1.05,13]trideca-7,9(13),10-trien-2-yl)methyl]piperidin-4-yl]carbamic acid (PubChem CID 66839770) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is tert-butyl-[1-[(6,12-dioxo-1,5-diazatricyclo[7.3.1.05,13]trideca-7,9(13),10-trien-2-yl)methyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[(6,12-dioxo-1,5-diazatricyclo[7.3.1.05,13]trideca-7,9(13),10-trien-2-yl)methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66839770 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | tert-butyl-[1-[(6,12-dioxo-1,5-diazatricyclo[7.3.1.05,13]trideca-7,9(13),10-trien-2-yl)methyl]piperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(CC2CCn3c(=O)ccc4ccc(=O)n2c43)CC1 |
| InChI | InChI=1S/C22H30N4O4/c1-22(2,3)26(21(29)30)16-8-11-23(12-9-16)14-17-10-13-24-18(27)6-4-15-5-7-19(28)25(17)20(15)24/h4-7,16-17H,8-14H2,1-3H3,(H,29,30) |
| InChIKey | RSUIUYYUPFIUCN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 87.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |