About 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one
9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 66839776) has the molecular formula C21H22F2N4O2
and a molecular weight of 400.43 g/mol. Its IUPAC name is 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one.
Molecular Properties
| Compound Name | 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one |
| PubChem CID | 66839776 |
| Molecular Formula | C21H22F2N4O2 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1cc(C(C)Nc2cc(F)cc(F)c2)c2nc(N3CCOCC3)cc(=O)n2c1 |
| InChI | InChI=1S/C21H22F2N4O2/c1-13-7-18(14(2)24-17-9-15(22)8-16(23)10-17)21-25-19(11-20(28)27(21)12-13)26-3-5-29-6-4-26/h7-12,14,24H,3-6H2,1-2H3 |
| InChIKey | XDLIVPXYLKDDJK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one?
The IUPAC name of 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one (CID 66839776) is 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one.
What is the SMILES notation for 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one?
The canonical SMILES for 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one is Cc1cc(C(C)Nc2cc(F)cc(F)c2)c2nc(N3CCOCC3)cc(=O)n2c1.
What is the InChIKey of 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one?
The InChIKey is XDLIVPXYLKDDJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22F2N4O2/c1-13-7-18(14(2)24-17-9-15(22)8-16(23)10-17)21-25-19(11-20(28)27(21)12-13)26-3-5-29-6-4-26/h7-12,14,24H,3-6H2,1-2H3.
What are the key properties of 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one?
9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one has a molecular weight of 400.43 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[1-(3,5-difluoroanilino)ethyl]-7-methyl-2-morpholin-4-ylpyrido[1,2-a]pyrimidin-4-one is sourced from PubChem (CID 66839776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).