C21H29N5O4 — CID 66839839
tert-butyl-[1-[[(10S)-2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl]methyl]piperidin-4-yl]carbamic acid (PubChem CID 66839839) has the molecular formula C21H29N5O4 and a molecular weight of 415.49 g/mol. Its IUPAC name is tert-butyl-[1-[[(10S)-2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl]methyl]piperidin-4-yl]carbamic acid.
| Compound Name | tert-butyl-[1-[[(10S)-2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl]methyl]piperidin-4-yl]carbamic acid |
|---|---|
| PubChem CID | 66839839 |
| Molecular Formula | C21H29N5O4 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | tert-butyl-[1-[[(10S)-2,8-dioxo-1,4,9-triazatricyclo[7.3.1.05,13]trideca-3,5(13),6-trien-10-yl]methyl]piperidin-4-yl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C1CCN(C[C@@H]2CCn3c(=O)cnc4ccc(=O)n2c43)CC1 |
| InChI | InChI=1S/C21H29N5O4/c1-21(2,3)26(20(29)30)14-6-9-23(10-7-14)13-15-8-11-24-18(28)12-22-16-4-5-17(27)25(15)19(16)24/h4-5,12,14-15H,6-11,13H2,1-3H3,(H,29,30)/t15-/m0/s1 |
| InChIKey | UCMVBVRYEBEXSI-HNNXBMFYSA-N |
| XLogP | 1.75 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |