C21H27N3O3 — CID 66840220
[4-[2-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]cyclohexyl]carbamic acid (PubChem CID 66840220) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is [4-[2-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]cyclohexyl]carbamic acid.
| Compound Name | [4-[2-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]cyclohexyl]carbamic acid |
|---|---|
| PubChem CID | 66840220 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | [4-[2-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]ethyl]cyclohexyl]carbamic acid |
| SMILES | N#Cc1ccc2c(c1)[C@@H]1CN(CCC3CCC(NC(=O)O)CC3)C[C@H]1CO2 |
| InChI | InChI=1S/C21H27N3O3/c22-10-15-3-6-20-18(9-15)19-12-24(11-16(19)13-27-20)8-7-14-1-4-17(5-2-14)23-21(25)26/h3,6,9,14,16-17,19,23H,1-2,4-5,7-8,11-13H2,(H,25,26)/t14?,16-,17?,19+/m0/s1 |
| InChIKey | JIWBNPRMRZNEOF-VHHHDHQQSA-N |
| XLogP | 3.18 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |