C22H25N5O3S — CID 66840356
(7-methoxy-3-methyl-1H-indol-2-yl)-[4-[1-(1,3-thiazole-2-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone (PubChem CID 66840356) has the molecular formula C22H25N5O3S and a molecular weight of 439.54 g/mol. Its IUPAC name is (7-methoxy-3-methyl-1H-indol-2-yl)-[4-[1-(1,3-thiazole-2-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone.
| Compound Name | (7-methoxy-3-methyl-1H-indol-2-yl)-[4-[1-(1,3-thiazole-2-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 66840356 |
| Molecular Formula | C22H25N5O3S |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (7-methoxy-3-methyl-1H-indol-2-yl)-[4-[1-(1,3-thiazole-2-carbonyl)azetidin-3-yl]piperazin-1-yl]methanone |
| SMILES | COc1cccc2c(C)c(C(=O)N3CCN(C4CN(C(=O)c5nccs5)C4)CC3)[nH]c12 |
| InChI | InChI=1S/C22H25N5O3S/c1-14-16-4-3-5-17(30-2)19(16)24-18(14)21(28)26-9-7-25(8-10-26)15-12-27(13-15)22(29)20-23-6-11-31-20/h3-6,11,15,24H,7-10,12-13H2,1-2H3 |
| InChIKey | KRLWGGMILKJPOW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|