About N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide
N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide (PubChem CID 66840512) has the molecular formula C23H31FN2O
and a molecular weight of 370.51 g/mol. Its IUPAC name is N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide.
Molecular Properties
| Compound Name | N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide |
| PubChem CID | 66840512 |
| Molecular Formula | C23H31FN2O |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide |
| SMILES | CCN(/C=N/c1cc(C)c(Oc2ccc(F)c(C(C)(C)C)c2)cc1C)CC |
| InChI | InChI=1S/C23H31FN2O/c1-8-26(9-2)15-25-21-12-17(4)22(13-16(21)3)27-18-10-11-20(24)19(14-18)23(5,6)7/h10-15H,8-9H2,1-7H3/b25-15+ |
| InChIKey | JEATUPZLQXSWLZ-MFKUBSTISA-N |
| XLogP | 6.53 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide?
The IUPAC name of N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide (CID 66840512) is N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide.
What is the SMILES notation for N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide?
The canonical SMILES for N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide is CCN(/C=N/c1cc(C)c(Oc2ccc(F)c(C(C)(C)C)c2)cc1C)CC.
What is the InChIKey of N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide?
The InChIKey is JEATUPZLQXSWLZ-MFKUBSTISA-N. The full InChI is InChI=1S/C23H31FN2O/c1-8-26(9-2)15-25-21-12-17(4)22(13-16(21)3)27-18-10-11-20(24)19(14-18)23(5,6)7/h10-15H,8-9H2,1-7H3/b25-15+.
What are the key properties of N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide?
N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide has a molecular weight of 370.51 g/mol, XLogP of 6.53, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(3-tert-butyl-4-fluorophenoxy)-2,5-dimethylphenyl]-N,N-diethylmethanimidamide is sourced from PubChem (CID 66840512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).