About 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid
3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid (PubChem CID 66840853) has the molecular formula C11H11F2NO4S
and a molecular weight of 291.27 g/mol. Its IUPAC name is 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid.
Molecular Properties
| Compound Name | 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid |
| PubChem CID | 66840853 |
| Molecular Formula | C11H11F2NO4S |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid |
| SMILES | CS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)C1CC1 |
| InChI | InChI=1S/C11H11F2NO4S/c1-19(17,18)14(6-2-3-6)8-5-4-7(12)9(10(8)13)11(15)16/h4-6H,2-3H2,1H3,(H,15,16) |
| InChIKey | UWSWHTYBOTUHJB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid?
The IUPAC name of 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid (CID 66840853) is 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid.
What is the SMILES notation for 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid?
The canonical SMILES for 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid is CS(=O)(=O)N(c1ccc(F)c(C(=O)O)c1F)C1CC1.
What is the InChIKey of 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid?
The InChIKey is UWSWHTYBOTUHJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F2NO4S/c1-19(17,18)14(6-2-3-6)8-5-4-7(12)9(10(8)13)11(15)16/h4-6H,2-3H2,1H3,(H,15,16).
What are the key properties of 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid?
3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid has a molecular weight of 291.27 g/mol, XLogP of 1.59, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[cyclopropyl(methylsulfonyl)amino]-2,6-difluorobenzoic acid is sourced from PubChem (CID 66840853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).