About pyrimido[4,5-e][1,3]oxazin-4-one
pyrimido[4,5-e][1,3]oxazin-4-one (PubChem CID 66841268) has the molecular formula C6H3N3O2
and a molecular weight of 149.11 g/mol. Its IUPAC name is pyrimido[4,5-e][1,3]oxazin-4-one.
Molecular Properties
| Compound Name | pyrimido[4,5-e][1,3]oxazin-4-one |
| PubChem CID | 66841268 |
| Molecular Formula | C6H3N3O2 |
| Molecular Weight | 149.11 g/mol |
| Exact Mass | 149.02 |
| IUPAC Name | pyrimido[4,5-e][1,3]oxazin-4-one |
| SMILES | O=c1ncoc2cncnc12 |
| InChI | InChI=1S/C6H3N3O2/c10-6-5-4(11-3-9-6)1-7-2-8-5/h1-3H |
| InChIKey | WWRFTHDXAWHCTD-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze pyrimido[4,5-e][1,3]oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrimido[4,5-e][1,3]oxazin-4-one?
The IUPAC name of pyrimido[4,5-e][1,3]oxazin-4-one (CID 66841268) is pyrimido[4,5-e][1,3]oxazin-4-one.
What is the SMILES notation for pyrimido[4,5-e][1,3]oxazin-4-one?
The canonical SMILES for pyrimido[4,5-e][1,3]oxazin-4-one is O=c1ncoc2cncnc12.
What is the InChIKey of pyrimido[4,5-e][1,3]oxazin-4-one?
The InChIKey is WWRFTHDXAWHCTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O2/c10-6-5-4(11-3-9-6)1-7-2-8-5/h1-3H.
What are the key properties of pyrimido[4,5-e][1,3]oxazin-4-one?
pyrimido[4,5-e][1,3]oxazin-4-one has a molecular weight of 149.11 g/mol, XLogP of -0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for pyrimido[4,5-e][1,3]oxazin-4-one is sourced from PubChem (CID 66841268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).