About [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate
[(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate (PubChem CID 66841456) has the molecular formula C14H27NO3
and a molecular weight of 257.37 g/mol. Its IUPAC name is [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate |
| PubChem CID | 66841456 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate |
| SMILES | C[C@@H]1CN(C[C@@H](C)O)CC[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H27NO3/c1-10-8-15(9-11(2)16)7-6-12(10)18-13(17)14(3,4)5/h10-12,16H,6-9H2,1-5H3/t10-,11-,12-/m1/s1 |
| InChIKey | YGEXZGJIYCCXSW-IJLUTSLNSA-N |
| XLogP | 1.67 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate?
The IUPAC name of [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate (CID 66841456) is [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate is C[C@@H]1CN(C[C@@H](C)O)CC[C@H]1OC(=O)C(C)(C)C.
What is the InChIKey of [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate?
The InChIKey is YGEXZGJIYCCXSW-IJLUTSLNSA-N. The full InChI is InChI=1S/C14H27NO3/c1-10-8-15(9-11(2)16)7-6-12(10)18-13(17)14(3,4)5/h10-12,16H,6-9H2,1-5H3/t10-,11-,12-/m1/s1.
What are the key properties of [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate?
[(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate has a molecular weight of 257.37 g/mol, XLogP of 1.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R)-1-[(2R)-2-hydroxypropyl]-3-methylpiperidin-4-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 66841456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).