About 2-pyrazin-2-yl-1,3-oxazin-4-one
2-pyrazin-2-yl-1,3-oxazin-4-one (PubChem CID 66841836) has the molecular formula C8H5N3O2
and a molecular weight of 175.15 g/mol. Its IUPAC name is 2-pyrazin-2-yl-1,3-oxazin-4-one.
Molecular Properties
| Compound Name | 2-pyrazin-2-yl-1,3-oxazin-4-one |
| PubChem CID | 66841836 |
| Molecular Formula | C8H5N3O2 |
| Molecular Weight | 175.15 g/mol |
| Exact Mass | 175.04 |
| IUPAC Name | 2-pyrazin-2-yl-1,3-oxazin-4-one |
| SMILES | O=c1ccoc(-c2cnccn2)n1 |
| InChI | InChI=1S/C8H5N3O2/c12-7-1-4-13-8(11-7)6-5-9-2-3-10-6/h1-5H |
| InChIKey | QXCUVJZWTVLIAT-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.15 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-pyrazin-2-yl-1,3-oxazin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyrazin-2-yl-1,3-oxazin-4-one?
The IUPAC name of 2-pyrazin-2-yl-1,3-oxazin-4-one (CID 66841836) is 2-pyrazin-2-yl-1,3-oxazin-4-one.
What is the SMILES notation for 2-pyrazin-2-yl-1,3-oxazin-4-one?
The canonical SMILES for 2-pyrazin-2-yl-1,3-oxazin-4-one is O=c1ccoc(-c2cnccn2)n1.
What is the InChIKey of 2-pyrazin-2-yl-1,3-oxazin-4-one?
The InChIKey is QXCUVJZWTVLIAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3O2/c12-7-1-4-13-8(11-7)6-5-9-2-3-10-6/h1-5H.
What are the key properties of 2-pyrazin-2-yl-1,3-oxazin-4-one?
2-pyrazin-2-yl-1,3-oxazin-4-one has a molecular weight of 175.15 g/mol, XLogP of 0.49, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyrazin-2-yl-1,3-oxazin-4-one is sourced from PubChem (CID 66841836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).