About 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile
2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile (PubChem CID 66842227) has the molecular formula C22H15F2N3S
and a molecular weight of 391.45 g/mol. Its IUPAC name is 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile.
Molecular Properties
| Compound Name | 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile |
| PubChem CID | 66842227 |
| Molecular Formula | C22H15F2N3S |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile |
| SMILES | N#Cc1ccccc1Sc1cn(Cc2cc(F)cc(F)c2)c2cc(N)ccc12 |
| InChI | InChI=1S/C22H15F2N3S/c23-16-7-14(8-17(24)9-16)12-27-13-22(19-6-5-18(26)10-20(19)27)28-21-4-2-1-3-15(21)11-25/h1-10,13H,12,26H2 |
| InChIKey | NWDJVTBMOYWYSJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile?
The IUPAC name of 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile (CID 66842227) is 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile.
What is the SMILES notation for 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile?
The canonical SMILES for 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile is N#Cc1ccccc1Sc1cn(Cc2cc(F)cc(F)c2)c2cc(N)ccc12.
What is the InChIKey of 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile?
The InChIKey is NWDJVTBMOYWYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H15F2N3S/c23-16-7-14(8-17(24)9-16)12-27-13-22(19-6-5-18(26)10-20(19)27)28-21-4-2-1-3-15(21)11-25/h1-10,13H,12,26H2.
What are the key properties of 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile?
2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile has a molecular weight of 391.45 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[6-amino-1-[(3,5-difluorophenyl)methyl]indol-3-yl]sulfanylbenzonitrile is sourced from PubChem (CID 66842227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).