C18H27NO5 — CID 66842435
methyl 2-[[(5aR,9bS)-3a-hydroxy-5a,9-dimethyl-2-oxo-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-3-yl]methylamino]acetate (PubChem CID 66842435) has the molecular formula C18H27NO5 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl 2-[[(5aR,9bS)-3a-hydroxy-5a,9-dimethyl-2-oxo-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-3-yl]methylamino]acetate.
| Compound Name | methyl 2-[[(5aR,9bS)-3a-hydroxy-5a,9-dimethyl-2-oxo-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-3-yl]methylamino]acetate |
|---|---|
| PubChem CID | 66842435 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | methyl 2-[[(5aR,9bS)-3a-hydroxy-5a,9-dimethyl-2-oxo-4,5,6,7,8,9b-hexahydro-3H-benzo[g][1]benzofuran-3-yl]methylamino]acetate |
| SMILES | COC(=O)CNCC1C(=O)O[C@H]2C3=C(C)CCC[C@]3(C)CCC12O |
| InChI | InChI=1S/C18H27NO5/c1-11-5-4-6-17(2)7-8-18(22)12(9-19-10-13(20)23-3)16(21)24-15(18)14(11)17/h12,15,19,22H,4-10H2,1-3H3/t12?,15-,17+,18?/m0/s1 |
| InChIKey | TWIPDDOLRPPLSJ-UDYQRUHISA-N |
| XLogP | 1.32 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|