C38H42N2O7S — CID 6684252
ethyl 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate (PubChem CID 6684252) has the molecular formula C38H42N2O7S and a molecular weight of 670.83 g/mol. Its IUPAC name is ethyl 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate.
| Compound Name | ethyl 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
|---|---|
| PubChem CID | 6684252 |
| Molecular Formula | C38H42N2O7S |
| Molecular Weight | 670.83 g/mol |
| Exact Mass | 670.27 |
| IUPAC Name | ethyl 2-[[2-[4-[(2S,4R,5R,6S)-4-[4-(hydroxymethyl)phenyl]-6-[(2-methoxyphenyl)sulfanylmethyl]-5-methyl-1,3-dioxan-2-yl]phenyl]phenyl]methylcarbamoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)NCc1ccccc1-c1ccc([C@H]2OC(c3ccc(CO)cc3)[C@@H](C)[C@@H](CSc3ccccc3OC)O2)cc1 |
| InChI | InChI=1S/C38H42N2O7S/c1-4-45-35(42)22-40-38(43)39-21-30-9-5-6-10-31(30)27-17-19-29(20-18-27)37-46-33(24-48-34-12-8-7-11-32(34)44-3)25(2)36(47-37)28-15-13-26(23-41)14-16-28/h5-20,25,33,36-37,41H,4,21-24H2,1-3H3,(H2,39,40,43)/t25-,33+,36?,37+/m0/s1 |
| InChIKey | KWVPCJWYNXOZKB-VWYYCVAESA-N |
| XLogP | 6.80 |
| TPSA | 115.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.83 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |