About formaldehyde;naphthalen-1-ol
formaldehyde;naphthalen-1-ol (PubChem CID 66842551) has the molecular formula C11H10O2
and a molecular weight of 174.20 g/mol. Its IUPAC name is formaldehyde;naphthalen-1-ol.
Molecular Properties
| Compound Name | formaldehyde;naphthalen-1-ol |
| PubChem CID | 66842551 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | formaldehyde;naphthalen-1-ol |
| SMILES | C=O.Oc1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O.CH2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7,11H;1H2 |
| InChIKey | FLGPRDQFUUFZBL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze formaldehyde;naphthalen-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;naphthalen-1-ol?
The IUPAC name of formaldehyde;naphthalen-1-ol (CID 66842551) is formaldehyde;naphthalen-1-ol.
What is the SMILES notation for formaldehyde;naphthalen-1-ol?
The canonical SMILES for formaldehyde;naphthalen-1-ol is C=O.Oc1cccc2ccccc12.
What is the InChIKey of formaldehyde;naphthalen-1-ol?
The InChIKey is FLGPRDQFUUFZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O.CH2O/c11-10-7-3-5-8-4-1-2-6-9(8)10;1-2/h1-7,11H;1H2.
What are the key properties of formaldehyde;naphthalen-1-ol?
formaldehyde;naphthalen-1-ol has a molecular weight of 174.20 g/mol, XLogP of 2.36, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;naphthalen-1-ol is sourced from PubChem (CID 66842551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).