About tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine
tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine (PubChem CID 66842718) has the molecular formula C12H17N
and a molecular weight of 175.28 g/mol. Its IUPAC name is tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine.
Molecular Properties
| Compound Name | tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine |
| PubChem CID | 66842718 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine |
| SMILES | NC1=CCC2=C1C1CCCC(C2)C1 |
| InChI | InChI=1S/C12H17N/c13-11-5-4-10-7-8-2-1-3-9(6-8)12(10)11/h5,8-9H,1-4,6-7,13H2 |
| InChIKey | FHGWXOYFMZYQDF-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine?
The IUPAC name of tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine (CID 66842718) is tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine.
What is the SMILES notation for tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine?
The canonical SMILES for tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine is NC1=CCC2=C1C1CCCC(C2)C1.
What is the InChIKey of tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine?
The InChIKey is FHGWXOYFMZYQDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N/c13-11-5-4-10-7-8-2-1-3-9(6-8)12(10)11/h5,8-9H,1-4,6-7,13H2.
What are the key properties of tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine?
tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine has a molecular weight of 175.28 g/mol, XLogP of 2.74, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[6.3.1.02,6]dodeca-2(6),3-dien-3-amine is sourced from PubChem (CID 66842718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).