About 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole
1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole (PubChem CID 66843107) has the molecular formula C25H28N2
and a molecular weight of 356.51 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole.
Molecular Properties
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole |
| PubChem CID | 66843107 |
| Molecular Formula | C25H28N2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole |
| SMILES | Cc1cc(C)c(N2CN(c3c(C)cc(C)cc3C)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C25H28N2/c1-16-11-18(3)24(19(4)12-16)26-15-27(23-10-8-7-9-22(23)26)25-20(5)13-17(2)14-21(25)6/h7-14H,15H2,1-6H3 |
| InChIKey | BJJLKKJFPKPVKZ-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole?
The IUPAC name of 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole (CID 66843107) is 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole.
What is the SMILES notation for 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole?
The canonical SMILES for 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole is Cc1cc(C)c(N2CN(c3c(C)cc(C)cc3C)c3ccccc32)c(C)c1.
What is the InChIKey of 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole?
The InChIKey is BJJLKKJFPKPVKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H28N2/c1-16-11-18(3)24(19(4)12-16)26-15-27(23-10-8-7-9-22(23)26)25-20(5)13-17(2)14-21(25)6/h7-14H,15H2,1-6H3.
What are the key properties of 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole?
1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole has a molecular weight of 356.51 g/mol, XLogP of 6.78, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(2,4,6-trimethylphenyl)-2H-benzimidazole is sourced from PubChem (CID 66843107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).