C12H16O5 — CID 66843788
(2R,3S,4R)-6-phenylhex-5-ene-1,2,3,4,5-pentol (PubChem CID 66843788) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (2R,3S,4R)-6-phenylhex-5-ene-1,2,3,4,5-pentol.
| Compound Name | (2R,3S,4R)-6-phenylhex-5-ene-1,2,3,4,5-pentol |
|---|---|
| PubChem CID | 66843788 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (2R,3S,4R)-6-phenylhex-5-ene-1,2,3,4,5-pentol |
| SMILES | OC[C@@H](O)[C@H](O)[C@@H](O)C(O)=Cc1ccccc1 |
| InChI | InChI=1S/C12H16O5/c13-7-10(15)12(17)11(16)9(14)6-8-4-2-1-3-5-8/h1-6,10-17H,7H2/t10-,11+,12+/m1/s1 |
| InChIKey | VKFWQGFYGLIANZ-WOPDTQHZSA-N |
| XLogP | -0.34 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|