C39H35N3O5 — CID 66844171
3-[3-amino-4-[[5,6-bis(phenylmethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]-5-(1H-indazol-5-yl)phenyl]propanoic acid (PubChem CID 66844171) has the molecular formula C39H35N3O5 and a molecular weight of 625.73 g/mol. Its IUPAC name is 3-[3-amino-4-[[5,6-bis(phenylmethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]-5-(1H-indazol-5-yl)phenyl]propanoic acid.
| Compound Name | 3-[3-amino-4-[[5,6-bis(phenylmethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]-5-(1H-indazol-5-yl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 66844171 |
| Molecular Formula | C39H35N3O5 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.26 |
| IUPAC Name | 3-[3-amino-4-[[5,6-bis(phenylmethoxy)-2,3-dihydro-1H-inden-2-yl]oxy]-5-(1H-indazol-5-yl)phenyl]propanoic acid |
| SMILES | Nc1cc(CCC(=O)O)cc(-c2ccc3[nH]ncc3c2)c1OC1Cc2cc(OCc3ccccc3)c(OCc3ccccc3)cc2C1 |
| InChI | InChI=1S/C39H35N3O5/c40-34-16-27(11-14-38(43)44)15-33(28-12-13-35-31(17-28)22-41-42-35)39(34)47-32-18-29-20-36(45-23-25-7-3-1-4-8-25)37(21-30(29)19-32)46-24-26-9-5-2-6-10-26/h1-10,12-13,15-17,20-22,32H,11,14,18-19,23-24,40H2,(H,41,42)(H,43,44) |
| InChIKey | PXQPKDIGQWYZCS-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 119.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|