C17H36N2O+2 — CID 66844222
1,5-bis(1-methylpiperidin-1-ium-1-yl)pentan-1-ol (PubChem CID 66844222) has the molecular formula C17H36N2O+2 and a molecular weight of 284.49 g/mol. Its IUPAC name is 1,5-bis(1-methylpiperidin-1-ium-1-yl)pentan-1-ol.
| Compound Name | 1,5-bis(1-methylpiperidin-1-ium-1-yl)pentan-1-ol |
|---|---|
| PubChem CID | 66844222 |
| Molecular Formula | C17H36N2O+2 |
| Molecular Weight | 284.49 g/mol |
| Exact Mass | 284.28 |
| IUPAC Name | 1,5-bis(1-methylpiperidin-1-ium-1-yl)pentan-1-ol |
| SMILES | C[N+]1(CCCCC(O)[N+]2(C)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C17H36N2O/c1-18(12-6-3-7-13-18)14-10-5-11-17(20)19(2)15-8-4-9-16-19/h17,20H,3-16H2,1-2H3/q+2 |
| InChIKey | JJXHOIUHQYGRNC-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|