About 3-(aminomethyl)-2-fluorophenol;hydrobromide
3-(aminomethyl)-2-fluorophenol;hydrobromide (PubChem CID 66844432) has the molecular formula C7H9BrFNO
and a molecular weight of 222.06 g/mol. Its IUPAC name is 3-(aminomethyl)-2-fluorophenol;hydrobromide.
Molecular Properties
| Compound Name | 3-(aminomethyl)-2-fluorophenol;hydrobromide |
| PubChem CID | 66844432 |
| Molecular Formula | C7H9BrFNO |
| Molecular Weight | 222.06 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3-(aminomethyl)-2-fluorophenol;hydrobromide |
| SMILES | Br.NCc1cccc(O)c1F |
| InChI | InChI=1S/C7H8FNO.BrH/c8-7-5(4-9)2-1-3-6(7)10;/h1-3,10H,4,9H2;1H |
| InChIKey | RGXUBEPXBQKRHJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.06 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(aminomethyl)-2-fluorophenol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(aminomethyl)-2-fluorophenol;hydrobromide?
The IUPAC name of 3-(aminomethyl)-2-fluorophenol;hydrobromide (CID 66844432) is 3-(aminomethyl)-2-fluorophenol;hydrobromide.
What is the SMILES notation for 3-(aminomethyl)-2-fluorophenol;hydrobromide?
The canonical SMILES for 3-(aminomethyl)-2-fluorophenol;hydrobromide is Br.NCc1cccc(O)c1F.
What is the InChIKey of 3-(aminomethyl)-2-fluorophenol;hydrobromide?
The InChIKey is RGXUBEPXBQKRHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FNO.BrH/c8-7-5(4-9)2-1-3-6(7)10;/h1-3,10H,4,9H2;1H.
What are the key properties of 3-(aminomethyl)-2-fluorophenol;hydrobromide?
3-(aminomethyl)-2-fluorophenol;hydrobromide has a molecular weight of 222.06 g/mol, XLogP of 1.57, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(aminomethyl)-2-fluorophenol;hydrobromide is sourced from PubChem (CID 66844432), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).