C26H25N3O4 — CID 66844787
3-[3-amino-5-(1H-indazol-5-yl)-4-[(5-methoxy-2,3-dihydro-1H-inden-2-yl)oxy]phenyl]propanoic acid (PubChem CID 66844787) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[3-amino-5-(1H-indazol-5-yl)-4-[(5-methoxy-2,3-dihydro-1H-inden-2-yl)oxy]phenyl]propanoic acid.
| Compound Name | 3-[3-amino-5-(1H-indazol-5-yl)-4-[(5-methoxy-2,3-dihydro-1H-inden-2-yl)oxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 66844787 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | 3-[3-amino-5-(1H-indazol-5-yl)-4-[(5-methoxy-2,3-dihydro-1H-inden-2-yl)oxy]phenyl]propanoic acid |
| SMILES | COc1ccc2c(c1)CC(Oc1c(N)cc(CCC(=O)O)cc1-c1ccc3[nH]ncc3c1)C2 |
| InChI | InChI=1S/C26H25N3O4/c1-32-20-5-3-16-11-21(13-18(16)12-20)33-26-22(8-15(9-23(26)27)2-7-25(30)31)17-4-6-24-19(10-17)14-28-29-24/h3-6,8-10,12,14,21H,2,7,11,13,27H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | OQIGGTCMIOZVQI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|