About N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride
N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride (PubChem CID 66845539) has the molecular formula C21H19ClN2O4
and a molecular weight of 398.85 g/mol. Its IUPAC name is N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride.
Molecular Properties
| Compound Name | N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride |
| PubChem CID | 66845539 |
| Molecular Formula | C21H19ClN2O4 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride |
| SMILES | C/C(N)=N\c1ccc2oc(C3=COC(Cc4ccccc4)O3)cc(=O)c2c1.Cl |
| InChI | InChI=1S/C21H18N2O4.ClH/c1-13(22)23-15-7-8-18-16(10-15)17(24)11-19(26-18)20-12-25-21(27-20)9-14-5-3-2-4-6-14;/h2-8,10-12,21H,9H2,1H3,(H2,22,23);1H |
| InChIKey | SHLUTZBFDSIHDN-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride?
The IUPAC name of N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride (CID 66845539) is N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride.
What is the SMILES notation for N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride?
The canonical SMILES for N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride is C/C(N)=N\c1ccc2oc(C3=COC(Cc4ccccc4)O3)cc(=O)c2c1.Cl.
What is the InChIKey of N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride?
The InChIKey is SHLUTZBFDSIHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N2O4.ClH/c1-13(22)23-15-7-8-18-16(10-15)17(24)11-19(26-18)20-12-25-21(27-20)9-14-5-3-2-4-6-14;/h2-8,10-12,21H,9H2,1H3,(H2,22,23);1H.
What are the key properties of N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride?
N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride has a molecular weight of 398.85 g/mol, XLogP of 4.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[2-(2-benzyl-1,3-dioxol-4-yl)-4-oxochromen-6-yl]ethanimidamide;hydrochloride is sourced from PubChem (CID 66845539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).