About 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide
6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide (PubChem CID 66846016) has the molecular formula C20H14FN5OS
and a molecular weight of 391.43 g/mol. Its IUPAC name is 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide.
Molecular Properties
| Compound Name | 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide |
| PubChem CID | 66846016 |
| Molecular Formula | C20H14FN5OS |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide |
| SMILES | O=C(Nc1cnc2[nH]ccc2c1)c1cc2ccc(F)cc2n1Cc1nccs1 |
| InChI | InChI=1S/C20H14FN5OS/c21-14-2-1-12-8-17(26(16(12)9-14)11-18-22-5-6-28-18)20(27)25-15-7-13-3-4-23-19(13)24-10-15/h1-10H,11H2,(H,23,24)(H,25,27) |
| InChIKey | FURKZJDRQXBWGS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide?
The IUPAC name of 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide (CID 66846016) is 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide.
What is the SMILES notation for 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide?
The canonical SMILES for 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide is O=C(Nc1cnc2[nH]ccc2c1)c1cc2ccc(F)cc2n1Cc1nccs1.
What is the InChIKey of 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide?
The InChIKey is FURKZJDRQXBWGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14FN5OS/c21-14-2-1-12-8-17(26(16(12)9-14)11-18-22-5-6-28-18)20(27)25-15-7-13-3-4-23-19(13)24-10-15/h1-10H,11H2,(H,23,24)(H,25,27).
What are the key properties of 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide?
6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide has a molecular weight of 391.43 g/mol, XLogP of 4.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-N-(1H-pyrrolo[2,3-b]pyridin-5-yl)-1-(1,3-thiazol-2-ylmethyl)indole-2-carboxamide is sourced from PubChem (CID 66846016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).