About 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine
2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine (PubChem CID 668462) has the molecular formula C17H12ClFN2
and a molecular weight of 298.75 g/mol. Its IUPAC name is 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine.
Molecular Properties
| Compound Name | 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine |
| PubChem CID | 668462 |
| Molecular Formula | C17H12ClFN2 |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine |
| SMILES | Fc1cccc(Cl)c1C1Nc2cccc3cccc(c23)N1 |
| InChI | InChI=1S/C17H12ClFN2/c18-11-6-3-7-12(19)16(11)17-20-13-8-1-4-10-5-2-9-14(21-17)15(10)13/h1-9,17,20-21H |
| InChIKey | RZKKGVHUAWXVGC-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine?
The IUPAC name of 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine (CID 668462) is 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine.
What is the SMILES notation for 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine?
The canonical SMILES for 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine is Fc1cccc(Cl)c1C1Nc2cccc3cccc(c23)N1.
What is the InChIKey of 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine?
The InChIKey is RZKKGVHUAWXVGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12ClFN2/c18-11-6-3-7-12(19)16(11)17-20-13-8-1-4-10-5-2-9-14(21-17)15(10)13/h1-9,17,20-21H.
What are the key properties of 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine?
2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine has a molecular weight of 298.75 g/mol, XLogP of 5.17, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloro-6-fluorophenyl)-2,3-dihydro-1H-perimidine is sourced from PubChem (CID 668462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).