About 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane
2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane (PubChem CID 66846266) has the molecular formula C13H19ClO3Si
and a molecular weight of 286.83 g/mol. Its IUPAC name is 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane.
Molecular Properties
| Compound Name | 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane |
| PubChem CID | 66846266 |
| Molecular Formula | C13H19ClO3Si |
| Molecular Weight | 286.83 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane |
| SMILES | CCO[Si]1(CCc2ccc(CCl)cc2)OCCO1 |
| InChI | InChI=1S/C13H19ClO3Si/c1-2-15-18(16-8-9-17-18)10-7-12-3-5-13(11-14)6-4-12/h3-6H,2,7-11H2,1H3 |
| InChIKey | GTLGOQYRUSPORE-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.83 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane?
The IUPAC name of 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane (CID 66846266) is 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane.
What is the SMILES notation for 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane?
The canonical SMILES for 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane is CCO[Si]1(CCc2ccc(CCl)cc2)OCCO1.
What is the InChIKey of 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane?
The InChIKey is GTLGOQYRUSPORE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19ClO3Si/c1-2-15-18(16-8-9-17-18)10-7-12-3-5-13(11-14)6-4-12/h3-6H,2,7-11H2,1H3.
What are the key properties of 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane?
2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane has a molecular weight of 286.83 g/mol, XLogP of 2.99, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[4-(chloromethyl)phenyl]ethyl]-2-ethoxy-1,3,2-dioxasilolane is sourced from PubChem (CID 66846266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).