About 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine
2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine (PubChem CID 668463) has the molecular formula C19H18N2O2
and a molecular weight of 306.37 g/mol. Its IUPAC name is 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine.
Molecular Properties
| Compound Name | 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine |
| PubChem CID | 668463 |
| Molecular Formula | C19H18N2O2 |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine |
| SMILES | COc1cccc(C2Nc3cccc4cccc(c34)N2)c1OC |
| InChI | InChI=1S/C19H18N2O2/c1-22-16-11-5-8-13(18(16)23-2)19-20-14-9-3-6-12-7-4-10-15(21-19)17(12)14/h3-11,19-21H,1-2H3 |
| InChIKey | ZXCPEWASUSUSGE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'} |
|---|
Analyze 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine?
The IUPAC name of 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine (CID 668463) is 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine.
What is the SMILES notation for 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine?
The canonical SMILES for 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine is COc1cccc(C2Nc3cccc4cccc(c34)N2)c1OC.
What is the InChIKey of 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine?
The InChIKey is ZXCPEWASUSUSGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2/c1-22-16-11-5-8-13(18(16)23-2)19-20-14-9-3-6-12-7-4-10-15(21-19)17(12)14/h3-11,19-21H,1-2H3.
What are the key properties of 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine?
2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine has a molecular weight of 306.37 g/mol, XLogP of 4.39, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dimethoxyphenyl)-2,3-dihydro-1H-perimidine is sourced from PubChem (CID 668463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).