About 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline
1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline (PubChem CID 66846445) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline.
Molecular Properties
| Compound Name | 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline |
| PubChem CID | 66846445 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline |
| SMILES | CN1NCCc2c1cccc2S(C)(=O)=O |
| InChI | InChI=1S/C10H14N2O2S/c1-12-9-4-3-5-10(15(2,13)14)8(9)6-7-11-12/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | BHKHEWDGXODQRU-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline?
The IUPAC name of 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline (CID 66846445) is 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline.
What is the SMILES notation for 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline?
The canonical SMILES for 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline is CN1NCCc2c1cccc2S(C)(=O)=O.
What is the InChIKey of 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline?
The InChIKey is BHKHEWDGXODQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-12-9-4-3-5-10(15(2,13)14)8(9)6-7-11-12/h3-5,11H,6-7H2,1-2H3.
What are the key properties of 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline?
1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline has a molecular weight of 226.30 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-5-methylsulfonyl-3,4-dihydro-2H-cinnoline is sourced from PubChem (CID 66846445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).