C20H23N3O5 — CID 66846508
but-2-enedioic acid;5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-3-phenyl-1,2-oxazole (PubChem CID 66846508) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is but-2-enedioic acid;5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-3-phenyl-1,2-oxazole.
| Compound Name | but-2-enedioic acid;5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-3-phenyl-1,2-oxazole |
|---|---|
| PubChem CID | 66846508 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | but-2-enedioic acid;5-(2-methyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl)-3-phenyl-1,2-oxazole |
| SMILES | CN1CC2CN(c3cc(-c4ccccc4)no3)CC2C1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C16H19N3O.C4H4O4/c1-18-8-13-10-19(11-14(13)9-18)16-7-15(17-20-16)12-5-3-2-4-6-12;5-3(6)1-2-4(7)8/h2-7,13-14H,8-11H2,1H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | BFGWICGUEMUTPV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|