C11H12N4 — CID 66846626
6-pyrimidin-5-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine (PubChem CID 66846626) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 6-pyrimidin-5-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine.
| Compound Name | 6-pyrimidin-5-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 66846626 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 6-pyrimidin-5-yl-1,2,3,4-tetrahydropyrrolo[1,2-a]pyrazine |
| SMILES | c1ncc(-c2ccc3n2CCNC3)cn1 |
| InChI | InChI=1S/C11H12N4/c1-2-11(9-5-13-8-14-6-9)15-4-3-12-7-10(1)15/h1-2,5-6,8,12H,3-4,7H2 |
| InChIKey | XYWXQQBHEMOXIK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_C(8)', 'substructure': 'N/A'} |
|---|