About 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one
3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one (PubChem CID 66846643) has the molecular formula C22H18Cl2N4O4
and a molecular weight of 473.32 g/mol. Its IUPAC name is 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one.
Molecular Properties
| Compound Name | 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one |
| PubChem CID | 66846643 |
| Molecular Formula | C22H18Cl2N4O4 |
| Molecular Weight | 473.32 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one |
| SMILES | Cc1oc(=O)c(Nc2ccccc2)nc1Cl.Cc1oc(=O)c(Nc2ccccc2)nc1Cl |
| InChI | InChI=1S/2C11H9ClN2O2/c2*1-7-9(12)14-10(11(15)16-7)13-8-5-3-2-4-6-8/h2*2-6H,1H3,(H,13,14) |
| InChIKey | FQIZADCOQGYGPQ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 473.32 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one?
The IUPAC name of 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one (CID 66846643) is 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one.
What is the SMILES notation for 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one?
The canonical SMILES for 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one is Cc1oc(=O)c(Nc2ccccc2)nc1Cl.Cc1oc(=O)c(Nc2ccccc2)nc1Cl.
What is the InChIKey of 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one?
The InChIKey is FQIZADCOQGYGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C11H9ClN2O2/c2*1-7-9(12)14-10(11(15)16-7)13-8-5-3-2-4-6-8/h2*2-6H,1H3,(H,13,14).
What are the key properties of 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one?
3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one has a molecular weight of 473.32 g/mol, XLogP of 5.48, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-anilino-5-chloro-6-methyl-1,4-oxazin-2-one is sourced from PubChem (CID 66846643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).