C18H28Cl2O4Si — CID 66846664
3-[[2-[2-[3,4-bis(chloromethyl)phenyl]ethyl]-5-methyl-1,3,2-dioxasilinan-2-yl]oxy]-2-methylpropan-1-ol (PubChem CID 66846664) has the molecular formula C18H28Cl2O4Si and a molecular weight of 407.41 g/mol. Its IUPAC name is 3-[[2-[2-[3,4-bis(chloromethyl)phenyl]ethyl]-5-methyl-1,3,2-dioxasilinan-2-yl]oxy]-2-methylpropan-1-ol.
| Compound Name | 3-[[2-[2-[3,4-bis(chloromethyl)phenyl]ethyl]-5-methyl-1,3,2-dioxasilinan-2-yl]oxy]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 66846664 |
| Molecular Formula | C18H28Cl2O4Si |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 3-[[2-[2-[3,4-bis(chloromethyl)phenyl]ethyl]-5-methyl-1,3,2-dioxasilinan-2-yl]oxy]-2-methylpropan-1-ol |
| SMILES | CC(CO)CO[Si]1(CCc2ccc(CCl)c(CCl)c2)OCC(C)CO1 |
| InChI | InChI=1S/C18H28Cl2O4Si/c1-14(10-21)11-22-25(23-12-15(2)13-24-25)6-5-16-3-4-17(8-19)18(7-16)9-20/h3-4,7,14-15,21H,5-6,8-13H2,1-2H3 |
| InChIKey | BHBYZXWZNFABDF-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|