About 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride
4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride (PubChem CID 66846817) has the molecular formula C6H14ClNO3S
and a molecular weight of 215.70 g/mol. Its IUPAC name is 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride |
| PubChem CID | 66846817 |
| Molecular Formula | C6H14ClNO3S |
| Molecular Weight | 215.70 g/mol |
| Exact Mass | 215.04 |
| IUPAC Name | 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride |
| SMILES | Cl.NCC1(O)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C6H13NO3S.ClH/c7-5-6(8)1-3-11(9,10)4-2-6;/h8H,1-5,7H2;1H |
| InChIKey | ZSVQSDOSYBGNPJ-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.70 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride?
The IUPAC name of 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride (CID 66846817) is 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride.
What is the SMILES notation for 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride?
The canonical SMILES for 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride is Cl.NCC1(O)CCS(=O)(=O)CC1.
What is the InChIKey of 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride?
The InChIKey is ZSVQSDOSYBGNPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3S.ClH/c7-5-6(8)1-3-11(9,10)4-2-6;/h8H,1-5,7H2;1H.
What are the key properties of 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride?
4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride has a molecular weight of 215.70 g/mol, XLogP of -0.69, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-1,1-dioxothian-4-ol;hydrochloride is sourced from PubChem (CID 66846817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).