About 1,8-dimethyl-3,4-dihydro-2H-cinnoline
1,8-dimethyl-3,4-dihydro-2H-cinnoline (PubChem CID 66846857) has the molecular formula C10H14N2
and a molecular weight of 162.24 g/mol. Its IUPAC name is 1,8-dimethyl-3,4-dihydro-2H-cinnoline.
Molecular Properties
| Compound Name | 1,8-dimethyl-3,4-dihydro-2H-cinnoline |
| PubChem CID | 66846857 |
| Molecular Formula | C10H14N2 |
| Molecular Weight | 162.24 g/mol |
| Exact Mass | 162.12 |
| IUPAC Name | 1,8-dimethyl-3,4-dihydro-2H-cinnoline |
| SMILES | Cc1cccc2c1N(C)NCC2 |
| InChI | InChI=1S/C10H14N2/c1-8-4-3-5-9-6-7-11-12(2)10(8)9/h3-5,11H,6-7H2,1-2H3 |
| InChIKey | PMZRNJULKVVYAI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,8-dimethyl-3,4-dihydro-2H-cinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-dimethyl-3,4-dihydro-2H-cinnoline?
The IUPAC name of 1,8-dimethyl-3,4-dihydro-2H-cinnoline (CID 66846857) is 1,8-dimethyl-3,4-dihydro-2H-cinnoline.
What is the SMILES notation for 1,8-dimethyl-3,4-dihydro-2H-cinnoline?
The canonical SMILES for 1,8-dimethyl-3,4-dihydro-2H-cinnoline is Cc1cccc2c1N(C)NCC2.
What is the InChIKey of 1,8-dimethyl-3,4-dihydro-2H-cinnoline?
The InChIKey is PMZRNJULKVVYAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2/c1-8-4-3-5-9-6-7-11-12(2)10(8)9/h3-5,11H,6-7H2,1-2H3.
What are the key properties of 1,8-dimethyl-3,4-dihydro-2H-cinnoline?
1,8-dimethyl-3,4-dihydro-2H-cinnoline has a molecular weight of 162.24 g/mol, XLogP of 1.49, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-dimethyl-3,4-dihydro-2H-cinnoline is sourced from PubChem (CID 66846857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).