About 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid
4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid (PubChem CID 66846935) has the molecular formula C20H24N3O5P
and a molecular weight of 417.40 g/mol. Its IUPAC name is 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid.
Molecular Properties
| Compound Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid |
| PubChem CID | 66846935 |
| Molecular Formula | C20H24N3O5P |
| Molecular Weight | 417.40 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid |
| SMILES | Cc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C20H21N3O.H3O4P/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-5(2,3)4/h2-11,13,15H,12,14H2,1H3,(H2,21,24);(H3,1,2,3,4) |
| InChIKey | FXLAJSCYLSNQOU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 138.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid?
The IUPAC name of 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid (CID 66846935) is 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid.
What is the SMILES notation for 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid?
The canonical SMILES for 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid is Cc1nccn1CCC(C(N)=O)(c1ccccc1)c1ccccc1.O=P(O)(O)O.
What is the InChIKey of 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid?
The InChIKey is FXLAJSCYLSNQOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N3O.H3O4P/c1-16-22-13-15-23(16)14-12-20(19(21)24,17-8-4-2-5-9-17)18-10-6-3-7-11-18;1-5(2,3)4/h2-11,13,15H,12,14H2,1H3,(H2,21,24);(H3,1,2,3,4).
What are the key properties of 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid?
4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid has a molecular weight of 417.40 g/mol, XLogP of 2.12, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylimidazol-1-yl)-2,2-diphenylbutanamide;phosphoric acid is sourced from PubChem (CID 66846935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).