C12H13FN4 — CID 66846995
3-(6-fluoro-3-pyridinyl)-8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine (PubChem CID 66846995) has the molecular formula C12H13FN4 and a molecular weight of 232.26 g/mol. Its IUPAC name is 3-(6-fluoro-3-pyridinyl)-8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine.
| Compound Name | 3-(6-fluoro-3-pyridinyl)-8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 66846995 |
| Molecular Formula | C12H13FN4 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 3-(6-fluoro-3-pyridinyl)-8-methyl-5,6,7,8-tetrahydroimidazo[1,2-a]pyrazine |
| SMILES | CC1NCCn2c(-c3ccc(F)nc3)cnc21 |
| InChI | InChI=1S/C12H13FN4/c1-8-12-16-7-10(17(12)5-4-14-8)9-2-3-11(13)15-6-9/h2-3,6-8,14H,4-5H2,1H3 |
| InChIKey | QAVQUAFSZYEFDE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|