About 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine
1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine (PubChem CID 66847026) has the molecular formula C7H10N2S
and a molecular weight of 154.24 g/mol. Its IUPAC name is 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine.
Molecular Properties
| Compound Name | 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine |
| PubChem CID | 66847026 |
| Molecular Formula | C7H10N2S |
| Molecular Weight | 154.24 g/mol |
| Exact Mass | 154.06 |
| IUPAC Name | 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine |
| SMILES | CN1NCCc2sccc21 |
| InChI | InChI=1S/C7H10N2S/c1-9-6-3-5-10-7(6)2-4-8-9/h3,5,8H,2,4H2,1H3 |
| InChIKey | GSNPTUJMBZRVMD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine?
The IUPAC name of 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine (CID 66847026) is 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine.
What is the SMILES notation for 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine?
The canonical SMILES for 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine is CN1NCCc2sccc21.
What is the InChIKey of 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine?
The InChIKey is GSNPTUJMBZRVMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2S/c1-9-6-3-5-10-7(6)2-4-8-9/h3,5,8H,2,4H2,1H3.
What are the key properties of 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine?
1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine has a molecular weight of 154.24 g/mol, XLogP of 1.25, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,4-dihydro-2H-thieno[3,2-c]pyridazine is sourced from PubChem (CID 66847026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).