C46H42N2O7S — CID 6684713
2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid (PubChem CID 6684713) has the molecular formula C46H42N2O7S and a molecular weight of 766.92 g/mol. Its IUPAC name is 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid.
| Compound Name | 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
|---|---|
| PubChem CID | 6684713 |
| Molecular Formula | C46H42N2O7S |
| Molecular Weight | 766.92 g/mol |
| Exact Mass | 766.27 |
| IUPAC Name | 2-[[(2S,4S,5R,6R)-6-[4-(hydroxymethyl)phenyl]-5-methyl-2-[4-[2-[[(4-phenoxyphenyl)carbamoylamino]methyl]phenyl]phenyl]-1,3-dioxan-4-yl]methylsulfanyl]benzoic acid |
| SMILES | C[C@@H]1C(c2ccc(CO)cc2)O[C@H](c2ccc(-c3ccccc3CNC(=O)Nc3ccc(Oc4ccccc4)cc3)cc2)O[C@@H]1CSc1ccccc1C(=O)O |
| InChI | InChI=1S/C46H42N2O7S/c1-30-41(29-56-42-14-8-7-13-40(42)44(50)51)54-45(55-43(30)33-17-15-31(28-49)16-18-33)34-21-19-32(20-22-34)39-12-6-5-9-35(39)27-47-46(52)48-36-23-25-38(26-24-36)53-37-10-3-2-4-11-37/h2-26,30,41,43,45,49H,27-29H2,1H3,(H,50,51)(H2,47,48,52)/t30-,41+,43?,45+/m0/s1 |
| InChIKey | HQEDOTMPHUUXPJ-FXMCEFJJSA-N |
| XLogP | 10.24 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.92 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |